C21H36N6O — CID 111994685
N-[2-[[ethylamino-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 111994685) has the molecular formula C21H36N6O and a molecular weight of 388.56 g/mol. Its IUPAC name is N-[2-[[ethylamino-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[ethylamino-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111994685 |
| Molecular Formula | C21H36N6O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | N-[2-[[ethylamino-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)(C)C)NC1CCN(c2ccc(C)cn2)CC1 |
| InChI | InChI=1S/C21H36N6O/c1-6-22-20(24-12-11-23-19(28)21(3,4)5)26-17-9-13-27(14-10-17)18-8-7-16(2)15-25-18/h7-8,15,17H,6,9-14H2,1-5H3,(H,23,28)(H2,22,24,26) |
| InChIKey | XVHDAKKSZOZMKS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|