C19H36IN7O — CID 111997336
N-[2-[[ethylamino-[[1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111997336) has the molecular formula C19H36IN7O and a molecular weight of 505.45 g/mol. Its IUPAC name is N-[2-[[ethylamino-[[1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-[[1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111997336 |
| Molecular Formula | C19H36IN7O |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-[2-[[ethylamino-[[1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)(C)C)NC1CCCN(c2cnn(C)c2)C1.I |
| InChI | InChI=1S/C19H35N7O.HI/c1-6-20-18(22-10-9-21-17(27)19(2,3)4)24-15-8-7-11-26(13-15)16-12-23-25(5)14-16;/h12,14-15H,6-11,13H2,1-5H3,(H,21,27)(H2,20,22,24);1H |
| InChIKey | XSKYMFSYJCFGNL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|