C20H30ClIN6O — CID 111995448
2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine;hydroiodide (PubChem CID 111995448) has the molecular formula C20H30ClIN6O and a molecular weight of 532.86 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111995448 |
| Molecular Formula | C20H30ClIN6O |
| Molecular Weight | 532.86 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccccc1Cl)NC1CCCN(c2cnn(C)c2)C1.I |
| InChI | InChI=1S/C20H29ClN6O.HI/c1-3-22-20(23-12-19(28)17-8-4-5-9-18(17)21)25-15-7-6-10-27(13-15)16-11-24-26(2)14-16;/h4-5,8-9,11,14-15,19,28H,3,6-7,10,12-13H2,1-2H3,(H2,22,23,25);1H |
| InChIKey | POJMQYWEXQXWRK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.86 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|