C21H32N6O2 — CID 111995311
1-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine (PubChem CID 111995311) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111995311 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1cccc(OC)c1)NC1CCCN(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C21H32N6O2/c1-4-22-21(23-13-20(28)16-7-5-9-19(11-16)29-3)25-17-8-6-10-27(14-17)18-12-24-26(2)15-18/h5,7,9,11-12,15,17,20,28H,4,6,8,10,13-14H2,1-3H3,(H2,22,23,25) |
| InChIKey | UJSMKYUNHVBGEQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|