C24H35IN4O4 — CID 111996632
1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111996632) has the molecular formula C24H35IN4O4 and a molecular weight of 570.47 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111996632 |
| Molecular Formula | C24H35IN4O4 |
| Molecular Weight | 570.47 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cccc(OC)c1)NC1CCN(c2cc(OC)cc(OC)c2)C1.I |
| InChI | InChI=1S/C24H34N4O4.HI/c1-5-25-24(26-15-23(29)17-7-6-8-20(11-17)30-2)27-18-9-10-28(16-18)19-12-21(31-3)14-22(13-19)32-4;/h6-8,11-14,18,23,29H,5,9-10,15-16H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | HLTLMUPZSVPRNB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|