C24H35IN4O3 — CID 111994304
1-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-[1-(2-methoxyphenyl)piperidin-3-yl]guanidine;hydroiodide (PubChem CID 111994304) has the molecular formula C24H35IN4O3 and a molecular weight of 554.47 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-[1-(2-methoxyphenyl)piperidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-[1-(2-methoxyphenyl)piperidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111994304 |
| Molecular Formula | C24H35IN4O3 |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-[1-(2-methoxyphenyl)piperidin-3-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cccc(OC)c1)NC1CCCN(c2ccccc2OC)C1.I |
| InChI | InChI=1S/C24H34N4O3.HI/c1-4-25-24(26-16-22(29)18-9-7-11-20(15-18)30-2)27-19-10-8-14-28(17-19)21-12-5-6-13-23(21)31-3;/h5-7,9,11-13,15,19,22,29H,4,8,10,14,16-17H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | OWPZQONORQSVJG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|