C19H32IN3O2S — CID 111996782
1-ethyl-3-(3-ethylsulfanylcyclopentyl)-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111996782) has the molecular formula C19H32IN3O2S and a molecular weight of 493.46 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfanylcyclopentyl)-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-ethylsulfanylcyclopentyl)-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111996782 |
| Molecular Formula | C19H32IN3O2S |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfanylcyclopentyl)-2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cccc(OC)c1)NC1CCC(SCC)C1.I |
| InChI | InChI=1S/C19H31N3O2S.HI/c1-4-20-19(22-15-9-10-17(12-15)25-5-2)21-13-18(23)14-7-6-8-16(11-14)24-3;/h6-8,11,15,17-18,23H,4-5,9-10,12-13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | BREHRJVBRUYZGD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|