C19H30FN3OS — CID 111997383
1-ethyl-3-(3-ethylsulfanylcyclohexyl)-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine (PubChem CID 111997383) has the molecular formula C19H30FN3OS and a molecular weight of 367.53 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfanylcyclohexyl)-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfanylcyclohexyl)-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine |
|---|---|
| PubChem CID | 111997383 |
| Molecular Formula | C19H30FN3OS |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfanylcyclohexyl)-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(F)cc1)NC1CCCC(SCC)C1 |
| InChI | InChI=1S/C19H30FN3OS/c1-3-21-19(23-16-6-5-7-17(12-16)25-4-2)22-13-18(24)14-8-10-15(20)11-9-14/h8-11,16-18,24H,3-7,12-13H2,1-2H3,(H2,21,22,23) |
| InChIKey | SBLFNXBDVILITP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|