C21H34FIN4O — CID 111995442
1-[1-(cyclopentylmethyl)pyrrolidin-3-yl]-3-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine;hydroiodide (PubChem CID 111995442) has the molecular formula C21H34FIN4O and a molecular weight of 504.43 g/mol. Its IUPAC name is 1-[1-(cyclopentylmethyl)pyrrolidin-3-yl]-3-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(cyclopentylmethyl)pyrrolidin-3-yl]-3-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111995442 |
| Molecular Formula | C21H34FIN4O |
| Molecular Weight | 504.43 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 1-[1-(cyclopentylmethyl)pyrrolidin-3-yl]-3-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(F)cc1)NC1CCN(CC2CCCC2)C1.I |
| InChI | InChI=1S/C21H33FN4O.HI/c1-2-23-21(24-13-20(27)17-7-9-18(22)10-8-17)25-19-11-12-26(15-19)14-16-5-3-4-6-16;/h7-10,16,19-20,27H,2-6,11-15H2,1H3,(H2,23,24,25);1H |
| InChIKey | CAYGAIGARKXNFJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|