C21H34FIN4O3 — CID 111990974
tert-butyl 3-[[N-ethyl-N'-[2-(4-fluorophenyl)-2-hydroxyethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111990974) has the molecular formula C21H34FIN4O3 and a molecular weight of 536.43 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-[2-(4-fluorophenyl)-2-hydroxyethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-[2-(4-fluorophenyl)-2-hydroxyethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111990974 |
| Molecular Formula | C21H34FIN4O3 |
| Molecular Weight | 536.43 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-[2-(4-fluorophenyl)-2-hydroxyethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(F)cc1)NC1CCCN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C21H33FN4O3.HI/c1-5-23-19(24-13-18(27)15-8-10-16(22)11-9-15)25-17-7-6-12-26(14-17)20(28)29-21(2,3)4;/h8-11,17-18,27H,5-7,12-14H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | WQPLQWWCWHHPHD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|