C19H28FN5O3 — CID 109466096
tert-butyl 3-[[N-ethyl-N'-[2-(4-fluoroanilino)-2-oxoethyl]carbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109466096) has the molecular formula C19H28FN5O3 and a molecular weight of 393.46 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-[2-(4-fluoroanilino)-2-oxoethyl]carbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-[2-(4-fluoroanilino)-2-oxoethyl]carbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109466096 |
| Molecular Formula | C19H28FN5O3 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-[2-(4-fluoroanilino)-2-oxoethyl]carbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)cc1)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H28FN5O3/c1-5-21-17(22-10-16(26)23-14-8-6-13(20)7-9-14)24-15-11-25(12-15)18(27)28-19(2,3)4/h6-9,15H,5,10-12H2,1-4H3,(H,23,26)(H2,21,22,24) |
| InChIKey | IFAKOFLHDJPSDJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|