C23H31FIN5O3 — CID 111924814
2-[[[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide (PubChem CID 111924814) has the molecular formula C23H31FIN5O3 and a molecular weight of 571.44 g/mol. Its IUPAC name is 2-[[[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111924814 |
| Molecular Formula | C23H31FIN5O3 |
| Molecular Weight | 571.44 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | 2-[[[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)cc1)NC1CCN(c2cc(OC)cc(OC)c2)C1.I |
| InChI | InChI=1S/C23H30FN5O3.HI/c1-4-25-23(26-14-22(30)27-17-7-5-16(24)6-8-17)28-18-9-10-29(15-18)19-11-20(31-2)13-21(12-19)32-3;/h5-8,11-13,18H,4,9-10,14-15H2,1-3H3,(H,27,30)(H2,25,26,28);1H |
| InChIKey | DXIQLCKJWGQKBU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|