C22H28FN5O3 — CID 111925697
2-[[N-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-N-(4-fluorophenyl)acetamide (PubChem CID 111925697) has the molecular formula C22H28FN5O3 and a molecular weight of 429.50 g/mol. Its IUPAC name is 2-[[N-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[[N-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111925697 |
| Molecular Formula | C22H28FN5O3 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 2-[[N-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-N-(4-fluorophenyl)acetamide |
| SMILES | C/N=C(\NCC(=O)Nc1ccc(F)cc1)NC1CCN(c2cc(OC)cc(OC)c2)C1 |
| InChI | InChI=1S/C22H28FN5O3/c1-24-22(25-13-21(29)26-16-6-4-15(23)5-7-16)27-17-8-9-28(14-17)18-10-19(30-2)12-20(11-18)31-3/h4-7,10-12,17H,8-9,13-14H2,1-3H3,(H,26,29)(H2,24,25,27) |
| InChIKey | BFFPHCDJHCUMNX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|