C18H28FN5O — CID 111018139
N-(4-fluorophenyl)-2-[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]acetamide (PubChem CID 111018139) has the molecular formula C18H28FN5O and a molecular weight of 349.45 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111018139 |
| Molecular Formula | C18H28FN5O |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]acetamide |
| SMILES | CCCN1CCC(N/C(=N/C)NCC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H28FN5O/c1-3-10-24-11-8-16(9-12-24)23-18(20-2)21-13-17(25)22-15-6-4-14(19)5-7-15/h4-7,16H,3,8-13H2,1-2H3,(H,22,25)(H2,20,21,23) |
| InChIKey | WZPSXNGREFNKMU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|