C13H18N4O — CID 110934385
2-[(N-cyclopropyl-N'-methylcarbamimidoyl)amino]-N-phenylacetamide (PubChem CID 110934385) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[(N-cyclopropyl-N'-methylcarbamimidoyl)amino]-N-phenylacetamide.
| Compound Name | 2-[(N-cyclopropyl-N'-methylcarbamimidoyl)amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 110934385 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-[(N-cyclopropyl-N'-methylcarbamimidoyl)amino]-N-phenylacetamide |
| SMILES | C/N=C(\NCC(=O)Nc1ccccc1)NC1CC1 |
| InChI | InChI=1S/C13H18N4O/c1-14-13(17-11-7-8-11)15-9-12(18)16-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,16,18)(H2,14,15,17) |
| InChIKey | QMUKDCQBQXYDOS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|