C17H25FN4O — CID 111257049
N-(4-fluorophenyl)-2-[[N'-methyl-N-(4-methylcyclohexyl)carbamimidoyl]amino]acetamide (PubChem CID 111257049) has the molecular formula C17H25FN4O and a molecular weight of 320.41 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[N'-methyl-N-(4-methylcyclohexyl)carbamimidoyl]amino]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[[N'-methyl-N-(4-methylcyclohexyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111257049 |
| Molecular Formula | C17H25FN4O |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[N'-methyl-N-(4-methylcyclohexyl)carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)Nc1ccc(F)cc1)NC1CCC(C)CC1 |
| InChI | InChI=1S/C17H25FN4O/c1-12-3-7-15(8-4-12)22-17(19-2)20-11-16(23)21-14-9-5-13(18)6-10-14/h5-6,9-10,12,15H,3-4,7-8,11H2,1-2H3,(H,21,23)(H2,19,20,22) |
| InChIKey | XBJYJPMOUWDXJC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|