C19H31N5O — CID 111019267
N-[3-[[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]methyl]phenyl]acetamide (PubChem CID 111019267) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]methyl]phenyl]acetamide.
| Compound Name | N-[3-[[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 111019267 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | N-[3-[[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]methyl]phenyl]acetamide |
| SMILES | CCCN1CCC(N/C(=N/C)NCc2cccc(NC(C)=O)c2)CC1 |
| InChI | InChI=1S/C19H31N5O/c1-4-10-24-11-8-17(9-12-24)23-19(20-3)21-14-16-6-5-7-18(13-16)22-15(2)25/h5-7,13,17H,4,8-12,14H2,1-3H3,(H,22,25)(H2,20,21,23) |
| InChIKey | FHTZVNQDIKZKAB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|