C17H27IN4O — CID 75369581
N-[3-[[(N-cyclohexyl-N'-methylcarbamimidoyl)amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 75369581) has the molecular formula C17H27IN4O and a molecular weight of 430.33 g/mol. Its IUPAC name is N-[3-[[(N-cyclohexyl-N'-methylcarbamimidoyl)amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | N-[3-[[(N-cyclohexyl-N'-methylcarbamimidoyl)amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 75369581 |
| Molecular Formula | C17H27IN4O |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N-[3-[[(N-cyclohexyl-N'-methylcarbamimidoyl)amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(NC(C)=O)c1)NC1CCCCC1.I |
| InChI | InChI=1S/C17H26N4O.HI/c1-13(22)20-16-10-6-7-14(11-16)12-19-17(18-2)21-15-8-4-3-5-9-15;/h6-7,10-11,15H,3-5,8-9,12H2,1-2H3,(H,20,22)(H2,18,19,21);1H |
| InChIKey | FXCNGMHLVDLZNW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|