C19H29IN4O — CID 110989900
1-cyclopentyl-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 110989900) has the molecular formula C19H29IN4O and a molecular weight of 456.37 g/mol. Its IUPAC name is 1-cyclopentyl-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110989900 |
| Molecular Formula | C19H29IN4O |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 1-cyclopentyl-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(CN2CCCC2=O)c1)NC1CCCC1.I |
| InChI | InChI=1S/C19H28N4O.HI/c1-20-19(22-17-8-2-3-9-17)21-13-15-6-4-7-16(12-15)14-23-11-5-10-18(23)24;/h4,6-7,12,17H,2-3,5,8-11,13-14H2,1H3,(H2,20,21,22);1H |
| InChIKey | FOVBXMOMCOJHGR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|