C21H24F2N4O — CID 111901887
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111901887) has the molecular formula C21H24F2N4O and a molecular weight of 386.45 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111901887 |
| Molecular Formula | C21H24F2N4O |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1cccc(CN2CCCC2=O)c1)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C21H24F2N4O/c1-24-21(26-13-17-11-18(22)7-8-19(17)23)25-12-15-4-2-5-16(10-15)14-27-9-3-6-20(27)28/h2,4-5,7-8,10-11H,3,6,9,12-14H2,1H3,(H2,24,25,26) |
| InChIKey | ZNUUMRFWZUSPJH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|