C22H27F2IN4O — CID 111902562
1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111902562) has the molecular formula C22H27F2IN4O and a molecular weight of 528.39 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111902562 |
| Molecular Formula | C22H27F2IN4O |
| Molecular Weight | 528.39 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCC2=O)cc1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C22H26F2N4O.HI/c1-2-25-22(27-14-18-12-19(23)9-10-20(18)24)26-13-16-5-7-17(8-6-16)15-28-11-3-4-21(28)29;/h5-10,12H,2-4,11,13-15H2,1H3,(H2,25,26,27);1H |
| InChIKey | PPZKWRJGJZAKML-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|