C27H38IN5O — CID 111393616
1-ethyl-3-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111393616) has the molecular formula C27H38IN5O and a molecular weight of 575.54 g/mol. Its IUPAC name is 1-ethyl-3-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111393616 |
| Molecular Formula | C27H38IN5O |
| Molecular Weight | 575.54 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 1-ethyl-3-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCC2)cc1)NCc1ccc(CN2CCCC2=O)cc1.I |
| InChI | InChI=1S/C27H37N5O.HI/c1-2-28-27(29-18-22-7-11-24(12-8-22)20-31-15-3-4-16-31)30-19-23-9-13-25(14-10-23)21-32-17-5-6-26(32)33;/h7-14H,2-6,15-21H2,1H3,(H2,28,29,30);1H |
| InChIKey | FLJVHBJVOKJMOT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|