C26H43N5O — CID 111937161
1-[2-(azepan-1-yl)-3-methylbutyl]-3-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111937161) has the molecular formula C26H43N5O and a molecular weight of 441.66 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)-3-methylbutyl]-3-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-[2-(azepan-1-yl)-3-methylbutyl]-3-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111937161 |
| Molecular Formula | C26H43N5O |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.35 |
| IUPAC Name | 1-[2-(azepan-1-yl)-3-methylbutyl]-3-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCC2=O)cc1)NCC(C(C)C)N1CCCCCC1 |
| InChI | InChI=1S/C26H43N5O/c1-4-27-26(29-19-24(21(2)3)30-15-7-5-6-8-16-30)28-18-22-11-13-23(14-12-22)20-31-17-9-10-25(31)32/h11-14,21,24H,4-10,15-20H2,1-3H3,(H2,27,28,29) |
| InChIKey | HFDBJZWWRLDHTO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|