C22H34N4O2S — CID 109438441
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 109438441) has the molecular formula C22H34N4O2S and a molecular weight of 418.61 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109438441 |
| Molecular Formula | C22H34N4O2S |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCc2cccc(CN3CCCC3=O)c2)C1 |
| InChI | InChI=1S/C22H34N4O2S/c1-3-29(28)20-10-5-9-19(14-20)25-22(23-2)24-15-17-7-4-8-18(13-17)16-26-12-6-11-21(26)27/h4,7-8,13,19-20H,3,5-6,9-12,14-16H2,1-2H3,(H2,23,24,25) |
| InChIKey | DZOJTYIHCQGVEK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|