C21H29N3OS — CID 109439445
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(naphthalen-1-ylmethyl)guanidine (PubChem CID 109439445) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(naphthalen-1-ylmethyl)guanidine.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(naphthalen-1-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109439445 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(naphthalen-1-ylmethyl)guanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C21H29N3OS/c1-3-26(25)19-12-7-11-18(14-19)24-21(22-2)23-15-17-10-6-9-16-8-4-5-13-20(16)17/h4-6,8-10,13,18-19H,3,7,11-12,14-15H2,1-2H3,(H2,22,23,24) |
| InChIKey | VQPXIIUIQCOIST-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|