C19H31N3OS — CID 109437467
1-[(2-ethylphenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine (PubChem CID 109437467) has the molecular formula C19H31N3OS and a molecular weight of 349.54 g/mol. Its IUPAC name is 1-[(2-ethylphenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine.
| Compound Name | 1-[(2-ethylphenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109437467 |
| Molecular Formula | C19H31N3OS |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 1-[(2-ethylphenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
| SMILES | CCc1ccccc1CN/C(=N\C)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C19H31N3OS/c1-4-15-9-6-7-10-16(15)14-21-19(20-3)22-17-11-8-12-18(13-17)24(23)5-2/h6-7,9-10,17-18H,4-5,8,11-14H2,1-3H3,(H2,20,21,22) |
| InChIKey | MJKBFBHOJBAWRW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|