C17H25F2N3OS — CID 109439503
1-[(2,5-difluorophenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine (PubChem CID 109439503) has the molecular formula C17H25F2N3OS and a molecular weight of 357.47 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109439503 |
| Molecular Formula | C17H25F2N3OS |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCc2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C17H25F2N3OS/c1-3-24(23)15-6-4-5-14(10-15)22-17(20-2)21-11-12-9-13(18)7-8-16(12)19/h7-9,14-15H,3-6,10-11H2,1-2H3,(H2,20,21,22) |
| InChIKey | MOXNFFXUNGBEJP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|