C18H25FN4OS — CID 109437509
1-[(4-cyano-2-fluorophenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine (PubChem CID 109437509) has the molecular formula C18H25FN4OS and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-[(4-cyano-2-fluorophenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine.
| Compound Name | 1-[(4-cyano-2-fluorophenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109437509 |
| Molecular Formula | C18H25FN4OS |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-[(4-cyano-2-fluorophenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCc2ccc(C#N)cc2F)C1 |
| InChI | InChI=1S/C18H25FN4OS/c1-3-25(24)16-6-4-5-15(10-16)23-18(21-2)22-12-14-8-7-13(11-20)9-17(14)19/h7-9,15-16H,3-6,10,12H2,1-2H3,(H2,21,22,23) |
| InChIKey | QCLLDZBOPKQUKE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|