C19H32N4O3S2 — CID 109438345
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine (PubChem CID 109438345) has the molecular formula C19H32N4O3S2 and a molecular weight of 428.62 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109438345 |
| Molecular Formula | C19H32N4O3S2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCc2ccc(CS(=O)(=O)NC)cc2)C1 |
| InChI | InChI=1S/C19H32N4O3S2/c1-4-27(24)18-7-5-6-17(12-18)23-19(20-2)22-13-15-8-10-16(11-9-15)14-28(25,26)21-3/h8-11,17-18,21H,4-7,12-14H2,1-3H3,(H2,20,22,23) |
| InChIKey | VAXCCLGEJFUVAY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|