C23H39IN4O2S — CID 109440604
1-(3-ethylsulfinylcyclohexyl)-3-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 109440604) has the molecular formula C23H39IN4O2S and a molecular weight of 562.56 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-3-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-3-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109440604 |
| Molecular Formula | C23H39IN4O2S |
| Molecular Weight | 562.56 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-3-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCc2ccc(CN3CCC(O)CC3)cc2)C1.I |
| InChI | InChI=1S/C23H38N4O2S.HI/c1-3-30(29)22-6-4-5-20(15-22)26-23(24-2)25-16-18-7-9-19(10-8-18)17-27-13-11-21(28)12-14-27;/h7-10,20-22,28H,3-6,11-17H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | IVOSPPKFWAWIDM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|