C22H39IN6OS — CID 109439070
1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide (PubChem CID 109439070) has the molecular formula C22H39IN6OS and a molecular weight of 562.57 g/mol. Its IUPAC name is 1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109439070 |
| Molecular Formula | C22H39IN6OS |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | 1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide |
| SMILES | CCN1CCN(c2ccc(CN/C(=N\C)NC3CCCC(S(=O)CC)C3)cn2)CC1.I |
| InChI | InChI=1S/C22H38N6OS.HI/c1-4-27-11-13-28(14-12-27)21-10-9-18(16-24-21)17-25-22(23-3)26-19-7-6-8-20(15-19)30(29)5-2;/h9-10,16,19-20H,4-8,11-15,17H2,1-3H3,(H2,23,25,26);1H |
| InChIKey | LGUJAGVUECREFX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|