C18H26FIN4OS — CID 109438224
1-[(5-cyano-2-fluorophenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide (PubChem CID 109438224) has the molecular formula C18H26FIN4OS and a molecular weight of 492.40 g/mol. Its IUPAC name is 1-[(5-cyano-2-fluorophenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109438224 |
| Molecular Formula | C18H26FIN4OS |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCc2cc(C#N)ccc2F)C1.I |
| InChI | InChI=1S/C18H25FN4OS.HI/c1-3-25(24)16-6-4-5-15(10-16)23-18(21-2)22-12-14-9-13(11-20)7-8-17(14)19;/h7-9,15-16H,3-6,10,12H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | BZGYJGVDDRINNH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|