C20H30FN3OS — CID 109439467
1-(3-ethylsulfinylcyclohexyl)-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methylguanidine (PubChem CID 109439467) has the molecular formula C20H30FN3OS and a molecular weight of 379.55 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methylguanidine.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109439467 |
| Molecular Formula | C20H30FN3OS |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methylguanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCC2(c3cccc(F)c3)CC2)C1 |
| InChI | InChI=1S/C20H30FN3OS/c1-3-26(25)18-9-5-8-17(13-18)24-19(22-2)23-14-20(10-11-20)15-6-4-7-16(21)12-15/h4,6-7,12,17-18H,3,5,8-11,13-14H2,1-2H3,(H2,22,23,24) |
| InChIKey | QXOOOALCQBUCHM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|