C23H36FN3O2S — CID 109438103
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]guanidine (PubChem CID 109438103) has the molecular formula C23H36FN3O2S and a molecular weight of 437.63 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109438103 |
| Molecular Formula | C23H36FN3O2S |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1(c2cccc(F)c2)CCOCC1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C23H36FN3O2S/c1-3-25-22(27-20-9-6-10-21(16-20)30(28)4-2)26-17-23(11-13-29-14-12-23)18-7-5-8-19(24)15-18/h5,7-8,15,20-21H,3-4,6,9-14,16-17H2,1-2H3,(H2,25,26,27) |
| InChIKey | ORZSCQAVOSBOAX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|