C21H34IN3OS2 — CID 109439184
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(1-phenylsulfanylcyclopropyl)methyl]guanidine;hydroiodide (PubChem CID 109439184) has the molecular formula C21H34IN3OS2 and a molecular weight of 535.56 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(1-phenylsulfanylcyclopropyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(1-phenylsulfanylcyclopropyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109439184 |
| Molecular Formula | C21H34IN3OS2 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(1-phenylsulfanylcyclopropyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(Sc2ccccc2)CC1)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C21H33N3OS2.HI/c1-3-22-20(24-17-9-8-12-19(15-17)27(25)4-2)23-16-21(13-14-21)26-18-10-6-5-7-11-18;/h5-7,10-11,17,19H,3-4,8-9,12-16H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | NDGXEKRPIHZDIX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|