C21H35IN4O2S — CID 109437320
N-benzyl-3-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]propanamide;hydroiodide (PubChem CID 109437320) has the molecular formula C21H35IN4O2S and a molecular weight of 534.51 g/mol. Its IUPAC name is N-benzyl-3-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]propanamide;hydroiodide.
| Compound Name | N-benzyl-3-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 109437320 |
| Molecular Formula | C21H35IN4O2S |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | N-benzyl-3-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)NCc1ccccc1)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C21H34N4O2S.HI/c1-3-22-21(25-18-11-8-12-19(15-18)28(27)4-2)23-14-13-20(26)24-16-17-9-6-5-7-10-17;/h5-7,9-10,18-19H,3-4,8,11-16H2,1-2H3,(H,24,26)(H2,22,23,25);1H |
| InChIKey | SAVYSGGCQJEFGY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|