C15H31IN4O2S — CID 109437984
N-ethyl-2-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]acetamide;hydroiodide (PubChem CID 109437984) has the molecular formula C15H31IN4O2S and a molecular weight of 458.41 g/mol. Its IUPAC name is N-ethyl-2-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-ethyl-2-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109437984 |
| Molecular Formula | C15H31IN4O2S |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N-ethyl-2-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCNC(=O)C/N=C(\NCC)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C15H30N4O2S.HI/c1-4-16-14(20)11-18-15(17-5-2)19-12-8-7-9-13(10-12)22(21)6-3;/h12-13H,4-11H2,1-3H3,(H,16,20)(H2,17,18,19);1H |
| InChIKey | ZUVMDLXLRBARMD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|