C21H33FIN3OS — CID 111528186
1-ethyl-2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide (PubChem CID 111528186) has the molecular formula C21H33FIN3OS and a molecular weight of 521.48 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111528186 |
| Molecular Formula | C21H33FIN3OS |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 1-ethyl-2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2cccc(F)c2)CCOCC1)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C21H32FN3OS.HI/c1-3-23-20(25-18-7-8-19(14-18)27-2)24-15-21(9-11-26-12-10-21)16-5-4-6-17(22)13-16;/h4-6,13,18-19H,3,7-12,14-15H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | RYBDHBSHILYQNA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|