C15H21F2N3 — CID 111546661
1-cyclohexyl-3-[(2,5-difluorophenyl)methyl]-2-methylguanidine (PubChem CID 111546661) has the molecular formula C15H21F2N3 and a molecular weight of 281.35 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2,5-difluorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-cyclohexyl-3-[(2,5-difluorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111546661 |
| Molecular Formula | C15H21F2N3 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-cyclohexyl-3-[(2,5-difluorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1cc(F)ccc1F)NC1CCCCC1 |
| InChI | InChI=1S/C15H21F2N3/c1-18-15(20-13-5-3-2-4-6-13)19-10-11-9-12(16)7-8-14(11)17/h7-9,13H,2-6,10H2,1H3,(H2,18,19,20) |
| InChIKey | RQGOOHUVFZLISJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|