C14H20FN3O2S — CID 111824714
1-cyclopropyl-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine (PubChem CID 111824714) has the molecular formula C14H20FN3O2S and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-cyclopropyl-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-cyclopropyl-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111824714 |
| Molecular Formula | C14H20FN3O2S |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-cyclopropyl-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1cc(F)ccc1CS(C)(=O)=O)NC1CC1 |
| InChI | InChI=1S/C14H20FN3O2S/c1-16-14(18-13-5-6-13)17-8-11-7-12(15)4-3-10(11)9-21(2,19)20/h3-4,7,13H,5-6,8-9H2,1-2H3,(H2,16,17,18) |
| InChIKey | RCASXIJXWPQAQG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|