C23H30FN3O2S — CID 109444413
1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[2-(4-propan-2-ylphenyl)cyclopropyl]guanidine (PubChem CID 109444413) has the molecular formula C23H30FN3O2S and a molecular weight of 431.58 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[2-(4-propan-2-ylphenyl)cyclopropyl]guanidine.
| Compound Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[2-(4-propan-2-ylphenyl)cyclopropyl]guanidine |
|---|---|
| PubChem CID | 109444413 |
| Molecular Formula | C23H30FN3O2S |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[2-(4-propan-2-ylphenyl)cyclopropyl]guanidine |
| SMILES | C/N=C(\NCc1cc(F)ccc1CS(C)(=O)=O)NC1CC1c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C23H30FN3O2S/c1-15(2)16-5-7-17(8-6-16)21-12-22(21)27-23(25-3)26-13-19-11-20(24)10-9-18(19)14-30(4,28)29/h5-11,15,21-22H,12-14H2,1-4H3,(H2,25,26,27) |
| InChIKey | UWROZNUGNFKUJH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|