C19H29FIN3O2S — CID 109445672
1-(2,2-dicyclopropylethyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 109445672) has the molecular formula C19H29FIN3O2S and a molecular weight of 509.43 g/mol. Its IUPAC name is 1-(2,2-dicyclopropylethyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2,2-dicyclopropylethyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109445672 |
| Molecular Formula | C19H29FIN3O2S |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 1-(2,2-dicyclopropylethyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(F)ccc1CS(C)(=O)=O)NCC(C1CC1)C1CC1.I |
| InChI | InChI=1S/C19H28FN3O2S.HI/c1-21-19(23-11-18(13-3-4-13)14-5-6-14)22-10-16-9-17(20)8-7-15(16)12-26(2,24)25;/h7-9,13-14,18H,3-6,10-12H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | OKDGZAVHOBNNDJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|