C15H24FN3O2S2 — CID 109445633
1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(2-methylsulfanylpropyl)guanidine (PubChem CID 109445633) has the molecular formula C15H24FN3O2S2 and a molecular weight of 361.51 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(2-methylsulfanylpropyl)guanidine.
| Compound Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(2-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 109445633 |
| Molecular Formula | C15H24FN3O2S2 |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(2-methylsulfanylpropyl)guanidine |
| SMILES | C/N=C(/NCc1cc(F)ccc1CS(C)(=O)=O)NCC(C)SC |
| InChI | InChI=1S/C15H24FN3O2S2/c1-11(22-3)8-18-15(17-2)19-9-13-7-14(16)6-5-12(13)10-23(4,20)21/h5-7,11H,8-10H2,1-4H3,(H2,17,18,19) |
| InChIKey | SEQWFEHYUMAXFN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|