C23H33FN4O2S — CID 109444567
1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]guanidine (PubChem CID 109444567) has the molecular formula C23H33FN4O2S and a molecular weight of 448.61 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]guanidine.
| Compound Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109444567 |
| Molecular Formula | C23H33FN4O2S |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccccc1CN(C)C(C)C)NCc1cc(F)ccc1CS(C)(=O)=O |
| InChI | InChI=1S/C23H33FN4O2S/c1-17(2)28(4)15-19-9-7-6-8-18(19)13-26-23(25-3)27-14-21-12-22(24)11-10-20(21)16-31(5,29)30/h6-12,17H,13-16H2,1-5H3,(H2,25,26,27) |
| InChIKey | GNEDWWHNYDDEQW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|