C19H33FN4O2S — CID 109445953
1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[4-[methyl(propan-2-yl)amino]butyl]guanidine (PubChem CID 109445953) has the molecular formula C19H33FN4O2S and a molecular weight of 400.56 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[4-[methyl(propan-2-yl)amino]butyl]guanidine.
| Compound Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[4-[methyl(propan-2-yl)amino]butyl]guanidine |
|---|---|
| PubChem CID | 109445953 |
| Molecular Formula | C19H33FN4O2S |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[4-[methyl(propan-2-yl)amino]butyl]guanidine |
| SMILES | C/N=C(\NCCCCN(C)C(C)C)NCc1cc(F)ccc1CS(C)(=O)=O |
| InChI | InChI=1S/C19H33FN4O2S/c1-15(2)24(4)11-7-6-10-22-19(21-3)23-13-17-12-18(20)9-8-16(17)14-27(5,25)26/h8-9,12,15H,6-7,10-11,13-14H2,1-5H3,(H2,21,22,23) |
| InChIKey | LQUOVLCJXZAAMM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|