C20H26FN3O2S — CID 109446253
1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(3-phenylpropyl)guanidine (PubChem CID 109446253) has the molecular formula C20H26FN3O2S and a molecular weight of 391.51 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(3-phenylpropyl)guanidine.
| Compound Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(3-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 109446253 |
| Molecular Formula | C20H26FN3O2S |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(3-phenylpropyl)guanidine |
| SMILES | C/N=C(\NCCCc1ccccc1)NCc1cc(F)ccc1CS(C)(=O)=O |
| InChI | InChI=1S/C20H26FN3O2S/c1-22-20(23-12-6-9-16-7-4-3-5-8-16)24-14-18-13-19(21)11-10-17(18)15-27(2,25)26/h3-5,7-8,10-11,13H,6,9,12,14-15H2,1-2H3,(H2,22,23,24) |
| InChIKey | MVFSRXHJGSXZEF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|