C17H29FIN3O2S — CID 109445696
1-(3,3-dimethylbutyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 109445696) has the molecular formula C17H29FIN3O2S and a molecular weight of 485.41 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3,3-dimethylbutyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109445696 |
| Molecular Formula | C17H29FIN3O2S |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(C)(C)C)NCc1cc(F)ccc1CS(C)(=O)=O.I |
| InChI | InChI=1S/C17H28FN3O2S.HI/c1-17(2,3)8-9-20-16(19-4)21-11-14-10-15(18)7-6-13(14)12-24(5,22)23;/h6-7,10H,8-9,11-12H2,1-5H3,(H2,19,20,21);1H |
| InChIKey | BLEJVQXIYKZHEB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|