C20H33FIN3O2S — CID 109446422
1-(4-cyclopentylbutyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 109446422) has the molecular formula C20H33FIN3O2S and a molecular weight of 525.47 g/mol. Its IUPAC name is 1-(4-cyclopentylbutyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(4-cyclopentylbutyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109446422 |
| Molecular Formula | C20H33FIN3O2S |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | 1-(4-cyclopentylbutyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCC1CCCC1)NCc1cc(F)ccc1CS(C)(=O)=O.I |
| InChI | InChI=1S/C20H32FN3O2S.HI/c1-22-20(23-12-6-5-9-16-7-3-4-8-16)24-14-18-13-19(21)11-10-17(18)15-27(2,25)26;/h10-11,13,16H,3-9,12,14-15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | IFDBGRGPGCNSSL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|