C20H35FIN5O2S — CID 109445130
1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide (PubChem CID 109445130) has the molecular formula C20H35FIN5O2S and a molecular weight of 555.50 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109445130 |
| Molecular Formula | C20H35FIN5O2S |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCCN(C)CC1)NCc1cc(F)ccc1CS(C)(=O)=O.I |
| InChI | InChI=1S/C20H34FN5O2S.HI/c1-22-20(23-8-4-10-26-11-5-9-25(2)12-13-26)24-15-18-14-19(21)7-6-17(18)16-29(3,27)28;/h6-7,14H,4-5,8-13,15-16H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | CIRITPVIWKQQBK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|