C18H30Cl2IN5 — CID 111197497
1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111197497) has the molecular formula C18H30Cl2IN5 and a molecular weight of 514.28 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111197497 |
| Molecular Formula | C18H30Cl2IN5 |
| Molecular Weight | 514.28 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCCN(C)CC1)NCc1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C18H29Cl2N5.HI/c1-21-18(23-14-15-5-6-16(19)13-17(15)20)22-7-3-9-25-10-4-8-24(2)11-12-25;/h5-6,13H,3-4,7-12,14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | XDYCMKNVDCYYJK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|